C9H22N2 — CID 79001587
2-methyl-N-(2-methylpropyl)butane-1,4-diamine (PubChem CID 79001587) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)butane-1,4-diamine.
| Compound Name | 2-methyl-N-(2-methylpropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 79001587 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)butane-1,4-diamine |
| SMILES | CC(C)CNCC(C)CCN |
| InChI | InChI=1S/C9H22N2/c1-8(2)6-11-7-9(3)4-5-10/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | GPXVVFQSUGFSJS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |