C24H51N — CID 97464987
(2S,4S)-N-[(2R,4R)-2,4-diethyloctyl]-2,4-diethyloctan-1-amine (PubChem CID 97464987) has the molecular formula C24H51N and a molecular weight of 353.68 g/mol. Its IUPAC name is (2S,4S)-N-[(2R,4R)-2,4-diethyloctyl]-2,4-diethyloctan-1-amine.
| Compound Name | (2S,4S)-N-[(2R,4R)-2,4-diethyloctyl]-2,4-diethyloctan-1-amine |
|---|---|
| PubChem CID | 97464987 |
| Molecular Formula | C24H51N |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 353.40 |
| IUPAC Name | (2S,4S)-N-[(2R,4R)-2,4-diethyloctyl]-2,4-diethyloctan-1-amine |
| SMILES | CCCC[C@@H](CC)C[C@@H](CC)CNC[C@@H](CC)C[C@@H](CC)CCCC |
| InChI | InChI=1S/C24H51N/c1-7-13-15-21(9-3)17-23(11-5)19-25-20-24(12-6)18-22(10-4)16-14-8-2/h21-25H,7-20H2,1-6H3/t21-,22+,23-,24+ |
| InChIKey | TUWPUFVJJBETKM-WAPCQROESA-N |
| XLogP | 7.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |