C15H33N — CID 81016450
N,5-diethyl-2,3-dimethylnonan-1-amine (PubChem CID 81016450) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is N,5-diethyl-2,3-dimethylnonan-1-amine.
| Compound Name | N,5-diethyl-2,3-dimethylnonan-1-amine |
|---|---|
| PubChem CID | 81016450 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | N,5-diethyl-2,3-dimethylnonan-1-amine |
| SMILES | CCCCC(CC)CC(C)C(C)CNCC |
| InChI | InChI=1S/C15H33N/c1-6-9-10-15(7-2)11-13(4)14(5)12-16-8-3/h13-16H,6-12H2,1-5H3 |
| InChIKey | LVGCYWGYOCABEY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |