About 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol
3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol (PubChem CID 76929562) has the molecular formula C8H19NO3
and a molecular weight of 177.24 g/mol. Its IUPAC name is 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol.
Analyze 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol?
The IUPAC name of 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol (CID 76929562) is 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol.
What is the SMILES notation for 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol?
The canonical SMILES for 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol is COCC(C)CNCC(O)CO.
What is the InChIKey of 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol?
The InChIKey is FFLBVUWWQOTHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3/c1-7(6-12-2)3-9-4-8(11)5-10/h7-11H,3-6H2,1-2H3.
What are the key properties of 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol?
3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol has a molecular weight of 177.24 g/mol, XLogP of -0.79, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-methoxy-2-methylpropyl)amino]propane-1,2-diol is sourced from PubChem (CID 76929562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).