C14H26O2 — CID 54156858
3-hydroxy-3,4,4,5-tetramethyldec-1-en-1-one (PubChem CID 54156858) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-hydroxy-3,4,4,5-tetramethyldec-1-en-1-one.
| Compound Name | 3-hydroxy-3,4,4,5-tetramethyldec-1-en-1-one |
|---|---|
| PubChem CID | 54156858 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3-hydroxy-3,4,4,5-tetramethyldec-1-en-1-one |
| SMILES | CCCCCC(C)C(C)(C)C(C)(O)C=C=O |
| InChI | InChI=1S/C14H26O2/c1-6-7-8-9-12(2)13(3,4)14(5,16)10-11-15/h10,12,16H,6-9H2,1-5H3 |
| InChIKey | OLRPMZLTUYMLSO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|