C18H34 — CID 151006143
3-ethenyl-3,4,4,5-tetramethyldodec-1-ene (PubChem CID 151006143) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 3-ethenyl-3,4,4,5-tetramethyldodec-1-ene.
| Compound Name | 3-ethenyl-3,4,4,5-tetramethyldodec-1-ene |
|---|---|
| PubChem CID | 151006143 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 3-ethenyl-3,4,4,5-tetramethyldodec-1-ene |
| SMILES | C=CC(C)(C=C)C(C)(C)C(C)CCCCCCC |
| InChI | InChI=1S/C18H34/c1-8-11-12-13-14-15-16(4)17(5,6)18(7,9-2)10-3/h9-10,16H,2-3,8,11-15H2,1,4-7H3 |
| InChIKey | LVCUBHLEMLVJHI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|