C14H25N3O4 — CID 160652250
1,6-diisocyanato-5,6-dimethylheptane;ethyl carbamate (PubChem CID 160652250) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1,6-diisocyanato-5,6-dimethylheptane;ethyl carbamate.
| Compound Name | 1,6-diisocyanato-5,6-dimethylheptane;ethyl carbamate |
|---|---|
| PubChem CID | 160652250 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1,6-diisocyanato-5,6-dimethylheptane;ethyl carbamate |
| SMILES | CC(CCCCN=C=O)C(C)(C)N=C=O.CCOC(N)=O |
| InChI | InChI=1S/C11H18N2O2.C3H7NO2/c1-10(11(2,3)13-9-15)6-4-5-7-12-8-14;1-2-6-3(4)5/h10H,4-7H2,1-3H3;2H2,1H3,(H2,4,5) |
| InChIKey | RKOPRXMOOHDZFV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|