About 1-chlorosulfonyloxy-1,1-diisocyanatopentane
1-chlorosulfonyloxy-1,1-diisocyanatopentane (PubChem CID 88710573) has the molecular formula C7H9ClN2O5S
and a molecular weight of 268.68 g/mol. Its IUPAC name is 1-chlorosulfonyloxy-1,1-diisocyanatopentane.
Molecular Properties
| Compound Name | 1-chlorosulfonyloxy-1,1-diisocyanatopentane |
| PubChem CID | 88710573 |
| Molecular Formula | C7H9ClN2O5S |
| Molecular Weight | 268.68 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 1-chlorosulfonyloxy-1,1-diisocyanatopentane |
| SMILES | CCCCC(N=C=O)(N=C=O)OS(=O)(=O)Cl |
| InChI | InChI=1S/C7H9ClN2O5S/c1-2-3-4-7(9-5-11,10-6-12)15-16(8,13)14/h2-4H2,1H3 |
| InChIKey | GTDQGMFRMQSLMQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorosulfonyloxy-1,1-diisocyanatopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorosulfonyloxy-1,1-diisocyanatopentane?
The IUPAC name of 1-chlorosulfonyloxy-1,1-diisocyanatopentane (CID 88710573) is 1-chlorosulfonyloxy-1,1-diisocyanatopentane.
What is the SMILES notation for 1-chlorosulfonyloxy-1,1-diisocyanatopentane?
The canonical SMILES for 1-chlorosulfonyloxy-1,1-diisocyanatopentane is CCCCC(N=C=O)(N=C=O)OS(=O)(=O)Cl.
What is the InChIKey of 1-chlorosulfonyloxy-1,1-diisocyanatopentane?
The InChIKey is GTDQGMFRMQSLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O5S/c1-2-3-4-7(9-5-11,10-6-12)15-16(8,13)14/h2-4H2,1H3.
What are the key properties of 1-chlorosulfonyloxy-1,1-diisocyanatopentane?
1-chlorosulfonyloxy-1,1-diisocyanatopentane has a molecular weight of 268.68 g/mol, XLogP of 1.00, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorosulfonyloxy-1,1-diisocyanatopentane is sourced from PubChem (CID 88710573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).