C7H6F4N2O2 — CID 87981887
1,1,5,5-tetrafluoro-1,5-diisocyanatopentane (PubChem CID 87981887) has the molecular formula C7H6F4N2O2 and a molecular weight of 226.13 g/mol. Its IUPAC name is 1,1,5,5-tetrafluoro-1,5-diisocyanatopentane.
| Compound Name | 1,1,5,5-tetrafluoro-1,5-diisocyanatopentane |
|---|---|
| PubChem CID | 87981887 |
| Molecular Formula | C7H6F4N2O2 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1,1,5,5-tetrafluoro-1,5-diisocyanatopentane |
| SMILES | O=C=NC(F)(F)CCCC(F)(F)N=C=O |
| InChI | InChI=1S/C7H6F4N2O2/c8-6(9,12-4-14)2-1-3-7(10,11)13-5-15/h1-3H2 |
| InChIKey | URIWARQGBUPCNS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|