About (2S)-2-isocyanatooctane
(2S)-2-isocyanatooctane (PubChem CID 7018274) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is (2S)-2-isocyanatooctane.
Molecular Properties
| Compound Name | (2S)-2-isocyanatooctane |
| PubChem CID | 7018274 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (2S)-2-isocyanatooctane |
| SMILES | CCCCCC[C@H](C)N=C=O |
| InChI | InChI=1S/C9H17NO/c1-3-4-5-6-7-9(2)10-8-11/h9H,3-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | FTWPDIQXUDUDPL-VIFPVBQESA-N |
| XLogP | 2.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-isocyanatooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-isocyanatooctane?
The IUPAC name of (2S)-2-isocyanatooctane (CID 7018274) is (2S)-2-isocyanatooctane.
What is the SMILES notation for (2S)-2-isocyanatooctane?
The canonical SMILES for (2S)-2-isocyanatooctane is CCCCCC[C@H](C)N=C=O.
What is the InChIKey of (2S)-2-isocyanatooctane?
The InChIKey is FTWPDIQXUDUDPL-VIFPVBQESA-N. The full InChI is InChI=1S/C9H17NO/c1-3-4-5-6-7-9(2)10-8-11/h9H,3-7H2,1-2H3/t9-/m0/s1.
What are the key properties of (2S)-2-isocyanatooctane?
(2S)-2-isocyanatooctane has a molecular weight of 155.24 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-isocyanatooctane is sourced from PubChem (CID 7018274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).