About 1,1-diisocyanatohexane;hydrogen peroxide
1,1-diisocyanatohexane;hydrogen peroxide (PubChem CID 174421669) has the molecular formula C8H14N2O4
and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,1-diisocyanatohexane;hydrogen peroxide.
Molecular Properties
| Compound Name | 1,1-diisocyanatohexane;hydrogen peroxide |
| PubChem CID | 174421669 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,1-diisocyanatohexane;hydrogen peroxide |
| SMILES | CCCCCC(N=C=O)N=C=O.OO |
| InChI | InChI=1S/C8H12N2O2.H2O2/c1-2-3-4-5-8(9-6-11)10-7-12;1-2/h8H,2-5H2,1H3;1-2H |
| InChIKey | PMUIUFCYGPTSDA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diisocyanatohexane;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diisocyanatohexane;hydrogen peroxide?
The IUPAC name of 1,1-diisocyanatohexane;hydrogen peroxide (CID 174421669) is 1,1-diisocyanatohexane;hydrogen peroxide.
What is the SMILES notation for 1,1-diisocyanatohexane;hydrogen peroxide?
The canonical SMILES for 1,1-diisocyanatohexane;hydrogen peroxide is CCCCCC(N=C=O)N=C=O.OO.
What is the InChIKey of 1,1-diisocyanatohexane;hydrogen peroxide?
The InChIKey is PMUIUFCYGPTSDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.H2O2/c1-2-3-4-5-8(9-6-11)10-7-12;1-2/h8H,2-5H2,1H3;1-2H.
What are the key properties of 1,1-diisocyanatohexane;hydrogen peroxide?
1,1-diisocyanatohexane;hydrogen peroxide has a molecular weight of 202.21 g/mol, XLogP of 1.58, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diisocyanatohexane;hydrogen peroxide is sourced from PubChem (CID 174421669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).