About 4-isocyanatoheptane
4-isocyanatoheptane (PubChem CID 22102269) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 4-isocyanatoheptane.
Molecular Properties
| Compound Name | 4-isocyanatoheptane |
| PubChem CID | 22102269 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 4-isocyanatoheptane |
| SMILES | CCCC(CCC)N=C=O |
| InChI | InChI=1S/C8H15NO/c1-3-5-8(6-4-2)9-7-10/h8H,3-6H2,1-2H3 |
| InChIKey | MXACCRVHOAJKBF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanatoheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanatoheptane?
The IUPAC name of 4-isocyanatoheptane (CID 22102269) is 4-isocyanatoheptane.
What is the SMILES notation for 4-isocyanatoheptane?
The canonical SMILES for 4-isocyanatoheptane is CCCC(CCC)N=C=O.
What is the InChIKey of 4-isocyanatoheptane?
The InChIKey is MXACCRVHOAJKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-3-5-8(6-4-2)9-7-10/h8H,3-6H2,1-2H3.
What are the key properties of 4-isocyanatoheptane?
4-isocyanatoheptane has a molecular weight of 141.21 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanatoheptane is sourced from PubChem (CID 22102269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).