About 4-isocyanatononadecyl cyanate
4-isocyanatononadecyl cyanate (PubChem CID 162472649) has the molecular formula C21H38N2O2
and a molecular weight of 350.55 g/mol. Its IUPAC name is 4-isocyanatononadecyl cyanate.
Molecular Properties
| Compound Name | 4-isocyanatononadecyl cyanate |
| PubChem CID | 162472649 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 4-isocyanatononadecyl cyanate |
| SMILES | CCCCCCCCCCCCCCCC(CCCOC#N)N=C=O |
| InChI | InChI=1S/C21H38N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-21(23-20-24)17-15-18-25-19-22/h21H,2-18H2,1H3 |
| InChIKey | BCFABWJNBOAEBP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanatononadecyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanatononadecyl cyanate?
The IUPAC name of 4-isocyanatononadecyl cyanate (CID 162472649) is 4-isocyanatononadecyl cyanate.
What is the SMILES notation for 4-isocyanatononadecyl cyanate?
The canonical SMILES for 4-isocyanatononadecyl cyanate is CCCCCCCCCCCCCCCC(CCCOC#N)N=C=O.
What is the InChIKey of 4-isocyanatononadecyl cyanate?
The InChIKey is BCFABWJNBOAEBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-21(23-20-24)17-15-18-25-19-22/h21H,2-18H2,1H3.
What are the key properties of 4-isocyanatononadecyl cyanate?
4-isocyanatononadecyl cyanate has a molecular weight of 350.55 g/mol, XLogP of 6.45, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanatononadecyl cyanate is sourced from PubChem (CID 162472649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).