About 4-(cyanatomethyl)octyl cyanate
4-(cyanatomethyl)octyl cyanate (PubChem CID 166683935) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(cyanatomethyl)octyl cyanate.
Molecular Properties
| Compound Name | 4-(cyanatomethyl)octyl cyanate |
| PubChem CID | 166683935 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-(cyanatomethyl)octyl cyanate |
| SMILES | CCCCC(CCCOC#N)COC#N |
| InChI | InChI=1S/C11H18N2O2/c1-2-3-5-11(8-15-10-13)6-4-7-14-9-12/h11H,2-8H2,1H3 |
| InChIKey | UYSRVZVEMSMYGP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyanatomethyl)octyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyanatomethyl)octyl cyanate?
The IUPAC name of 4-(cyanatomethyl)octyl cyanate (CID 166683935) is 4-(cyanatomethyl)octyl cyanate.
What is the SMILES notation for 4-(cyanatomethyl)octyl cyanate?
The canonical SMILES for 4-(cyanatomethyl)octyl cyanate is CCCCC(CCCOC#N)COC#N.
What is the InChIKey of 4-(cyanatomethyl)octyl cyanate?
The InChIKey is UYSRVZVEMSMYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-2-3-5-11(8-15-10-13)6-4-7-14-9-12/h11H,2-8H2,1H3.
What are the key properties of 4-(cyanatomethyl)octyl cyanate?
4-(cyanatomethyl)octyl cyanate has a molecular weight of 210.28 g/mol, XLogP of 2.57, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyanatomethyl)octyl cyanate is sourced from PubChem (CID 166683935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).