C11H13NO — CID 175306715
bicyclo[2.2.0]hexa-1,3,5-triene;butyl cyanate (PubChem CID 175306715) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;butyl cyanate.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;butyl cyanate |
|---|---|
| PubChem CID | 175306715 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;butyl cyanate |
| SMILES | CCCCOC#N.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.C5H9NO/c1-2-6-4-3-5(1)6;1-2-3-4-7-5-6/h1-4H;2-4H2,1H3 |
| InChIKey | SKEQNTBABCCOPI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|