C9H21NO2 — CID 87982279
5-(diethylamino)pentane-1,3-diol (PubChem CID 87982279) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 5-(diethylamino)pentane-1,3-diol.
| Compound Name | 5-(diethylamino)pentane-1,3-diol |
|---|---|
| PubChem CID | 87982279 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 5-(diethylamino)pentane-1,3-diol |
| SMILES | CCN(CC)CCC(O)CCO |
| InChI | InChI=1S/C9H21NO2/c1-3-10(4-2)7-5-9(12)6-8-11/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | MKGUMTBEKHLUKP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |