C7H17NO2S — CID 123543844
5-[methyl(methylsulfanyl)amino]pentane-1,3-diol (PubChem CID 123543844) has the molecular formula C7H17NO2S and a molecular weight of 179.28 g/mol. Its IUPAC name is 5-[methyl(methylsulfanyl)amino]pentane-1,3-diol.
| Compound Name | 5-[methyl(methylsulfanyl)amino]pentane-1,3-diol |
|---|---|
| PubChem CID | 123543844 |
| Molecular Formula | C7H17NO2S |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.10 |
| IUPAC Name | 5-[methyl(methylsulfanyl)amino]pentane-1,3-diol |
| SMILES | CSN(C)CCC(O)CCO |
| InChI | InChI=1S/C7H17NO2S/c1-8(11-2)5-3-7(10)4-6-9/h7,9-10H,3-6H2,1-2H3 |
| InChIKey | TVPASSUZACQWKB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|