C9H21NO5 — CID 87694532
1-[bis(2-hydroxyethyl)amino]pentane-1,3,5-triol (PubChem CID 87694532) has the molecular formula C9H21NO5 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]pentane-1,3,5-triol.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]pentane-1,3,5-triol |
|---|---|
| PubChem CID | 87694532 |
| Molecular Formula | C9H21NO5 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]pentane-1,3,5-triol |
| SMILES | OCCC(O)CC(O)N(CCO)CCO |
| InChI | InChI=1S/C9H21NO5/c11-4-1-8(14)7-9(15)10(2-5-12)3-6-13/h8-9,11-15H,1-7H2 |
| InChIKey | GNCBZMVHCJUZSV-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|