About CID 173344063
CID 173344063 (PubChem CID 173344063) has the molecular formula C4H9O2Sn
and a molecular weight of 207.82 g/mol.
Molecular Properties
| Compound Name | CID 173344063 |
| PubChem CID | 173344063 |
| Molecular Formula | C4H9O2Sn |
| Molecular Weight | 207.82 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | — |
| SMILES | OCCC(O)C[Sn] |
| InChI | InChI=1S/C4H9O2.Sn/c1-4(6)2-3-5;/h4-6H,1-3H2; |
| InChIKey | AKECEIPVVRJPAK-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.82 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 173344063 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173344063?
The IUPAC name of CID 173344063 (CID 173344063) is not available.
What is the SMILES notation for CID 173344063?
The canonical SMILES for CID 173344063 is OCCC(O)C[Sn].
What is the InChIKey of CID 173344063?
The InChIKey is AKECEIPVVRJPAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2.Sn/c1-4(6)2-3-5;/h4-6H,1-3H2;.
What are the key properties of CID 173344063?
CID 173344063 has a molecular weight of 207.82 g/mol, XLogP of -0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173344063 is sourced from PubChem (CID 173344063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).