C5H12Na6O15S3 — CID 173024311
hexasodium;pentane-1,3,5-triol;trisulfate (PubChem CID 173024311) has the molecular formula C5H12Na6O15S3 and a molecular weight of 546.28 g/mol. Its IUPAC name is hexasodium;pentane-1,3,5-triol;trisulfate.
| Compound Name | hexasodium;pentane-1,3,5-triol;trisulfate |
|---|---|
| PubChem CID | 173024311 |
| Molecular Formula | C5H12Na6O15S3 |
| Molecular Weight | 546.28 g/mol |
| Exact Mass | 545.87 |
| IUPAC Name | hexasodium;pentane-1,3,5-triol;trisulfate |
| SMILES | O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].OCCC(O)CCO.[Na+].[Na+].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C5H12O3.6Na.3H2O4S/c6-3-1-5(8)2-4-7;;;;;;;3*1-5(2,3)4/h5-8H,1-4H2;;;;;;;3*(H2,1,2,3,4)/q;6*+1;;;/p-6 |
| InChIKey | HKMGAALKOVFBAV-UHFFFAOYSA-H |
| XLogP | -22.88 |
| TPSA | 301.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.28 |
| LogP ≤ 5 | -22.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|