C4H10Na2O6S — CID 158006830
disodium;2-methylpropane-1,3-diol;sulfate (PubChem CID 158006830) has the molecular formula C4H10Na2O6S and a molecular weight of 232.16 g/mol. Its IUPAC name is disodium;2-methylpropane-1,3-diol;sulfate.
| Compound Name | disodium;2-methylpropane-1,3-diol;sulfate |
|---|---|
| PubChem CID | 158006830 |
| Molecular Formula | C4H10Na2O6S |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | disodium;2-methylpropane-1,3-diol;sulfate |
| SMILES | CC(CO)CO.O=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H10O2.2Na.H2O4S/c1-4(2-5)3-6;;;1-5(2,3)4/h4-6H,2-3H2,1H3;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | FEJWKZPTCAOAFT-UHFFFAOYSA-L |
| XLogP | -7.72 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | -7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|