C6H16O2 — CID 87127502
ethane;2-methylpropane-1,3-diol (PubChem CID 87127502) has the molecular formula C6H16O2 and a molecular weight of 120.19 g/mol. Its IUPAC name is ethane;2-methylpropane-1,3-diol.
| Compound Name | ethane;2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 87127502 |
| Molecular Formula | C6H16O2 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.12 |
| IUPAC Name | ethane;2-methylpropane-1,3-diol |
| SMILES | CC.CC(CO)CO |
| InChI | InChI=1S/C4H10O2.C2H6/c1-4(2-5)3-6;1-2/h4-6H,2-3H2,1H3;1-2H3 |
| InChIKey | LQUUXAXCFUMGGW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |