About ethane;2-methylpropane-1,3-diol
ethane;2-methylpropane-1,3-diol (PubChem CID 87127502) has the molecular formula C6H16O2
and a molecular weight of 120.19 g/mol. Its IUPAC name is ethane;2-methylpropane-1,3-diol.
Molecular Properties
| Compound Name | ethane;2-methylpropane-1,3-diol |
| PubChem CID | 87127502 |
| Molecular Formula | C6H16O2 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.12 |
| IUPAC Name | ethane;2-methylpropane-1,3-diol |
| SMILES | CC.CC(CO)CO |
| InChI | InChI=1S/C4H10O2.C2H6/c1-4(2-5)3-6;1-2/h4-6H,2-3H2,1H3;1-2H3 |
| InChIKey | LQUUXAXCFUMGGW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane-1,3-diol?
The IUPAC name of ethane;2-methylpropane-1,3-diol (CID 87127502) is ethane;2-methylpropane-1,3-diol.
What is the SMILES notation for ethane;2-methylpropane-1,3-diol?
The canonical SMILES for ethane;2-methylpropane-1,3-diol is CC.CC(CO)CO.
What is the InChIKey of ethane;2-methylpropane-1,3-diol?
The InChIKey is LQUUXAXCFUMGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C2H6/c1-4(2-5)3-6;1-2/h4-6H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;2-methylpropane-1,3-diol?
ethane;2-methylpropane-1,3-diol has a molecular weight of 120.19 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane-1,3-diol is sourced from PubChem (CID 87127502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).