C13H32O9 — CID 159826635
butane-1,2,3,4-tetrol;3-methylbutane-1,2,4-triol;2-methylpropane-1,3-diol (PubChem CID 159826635) has the molecular formula C13H32O9 and a molecular weight of 332.39 g/mol. Its IUPAC name is butane-1,2,3,4-tetrol;3-methylbutane-1,2,4-triol;2-methylpropane-1,3-diol.
| Compound Name | butane-1,2,3,4-tetrol;3-methylbutane-1,2,4-triol;2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 159826635 |
| Molecular Formula | C13H32O9 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | butane-1,2,3,4-tetrol;3-methylbutane-1,2,4-triol;2-methylpropane-1,3-diol |
| SMILES | CC(CO)C(O)CO.CC(CO)CO.OCC(O)C(O)CO |
| InChI | InChI=1S/C5H12O3.C4H10O4.C4H10O2/c1-4(2-6)5(8)3-7;5-1-3(7)4(8)2-6;1-4(2-5)3-6/h4-8H,2-3H2,1H3;3-8H,1-2H2;4-6H,2-3H2,1H3 |
| InChIKey | NMXODUMEQFNADE-UHFFFAOYSA-N |
| XLogP | -3.73 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |