About (2R,3R)-4-sulfanylbutane-1,2,3-triol
(2R,3R)-4-sulfanylbutane-1,2,3-triol (PubChem CID 20617781) has the molecular formula C4H10O3S
and a molecular weight of 138.19 g/mol. Its IUPAC name is (2R,3R)-4-sulfanylbutane-1,2,3-triol.
Molecular Properties
| Compound Name | (2R,3R)-4-sulfanylbutane-1,2,3-triol |
| PubChem CID | 20617781 |
| Molecular Formula | C4H10O3S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | (2R,3R)-4-sulfanylbutane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)CS |
| InChI | InChI=1S/C4H10O3S/c5-1-3(6)4(7)2-8/h3-8H,1-2H2/t3-,4+/m1/s1 |
| InChIKey | COTLQGQWDIMCKQ-DMTCNVIQSA-N |
| XLogP | -1.37 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-4-sulfanylbutane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-4-sulfanylbutane-1,2,3-triol?
The IUPAC name of (2R,3R)-4-sulfanylbutane-1,2,3-triol (CID 20617781) is (2R,3R)-4-sulfanylbutane-1,2,3-triol.
What is the SMILES notation for (2R,3R)-4-sulfanylbutane-1,2,3-triol?
The canonical SMILES for (2R,3R)-4-sulfanylbutane-1,2,3-triol is OC[C@@H](O)[C@@H](O)CS.
What is the InChIKey of (2R,3R)-4-sulfanylbutane-1,2,3-triol?
The InChIKey is COTLQGQWDIMCKQ-DMTCNVIQSA-N. The full InChI is InChI=1S/C4H10O3S/c5-1-3(6)4(7)2-8/h3-8H,1-2H2/t3-,4+/m1/s1.
What are the key properties of (2R,3R)-4-sulfanylbutane-1,2,3-triol?
(2R,3R)-4-sulfanylbutane-1,2,3-triol has a molecular weight of 138.19 g/mol, XLogP of -1.37, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-4-sulfanylbutane-1,2,3-triol is sourced from PubChem (CID 20617781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).