C4H10O3S — CID 20617781
(2R,3R)-4-sulfanylbutane-1,2,3-triol (PubChem CID 20617781) has the molecular formula C4H10O3S and a molecular weight of 138.19 g/mol. Its IUPAC name is (2R,3R)-4-sulfanylbutane-1,2,3-triol.
| Compound Name | (2R,3R)-4-sulfanylbutane-1,2,3-triol |
|---|---|
| PubChem CID | 20617781 |
| Molecular Formula | C4H10O3S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | (2R,3R)-4-sulfanylbutane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)CS |
| InChI | InChI=1S/C4H10O3S/c5-1-3(6)4(7)2-8/h3-8H,1-2H2/t3-,4+/m1/s1 |
| InChIKey | COTLQGQWDIMCKQ-DMTCNVIQSA-N |
| XLogP | -1.37 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|