C4H14O2S4 — CID 90205919
(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;sulfane (PubChem CID 90205919) has the molecular formula C4H14O2S4 and a molecular weight of 222.42 g/mol. Its IUPAC name is (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;sulfane.
| Compound Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;sulfane |
|---|---|
| PubChem CID | 90205919 |
| Molecular Formula | C4H14O2S4 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;sulfane |
| SMILES | O[C@H](CS)[C@H](O)CS.S.S |
| InChI | InChI=1S/C4H10O2S2.2H2S/c5-3(1-7)4(6)2-8;;/h3-8H,1-2H2;2*1H2/t3-,4-;;/m1../s1 |
| InChIKey | OTPHQQOLZFQMKW-XWJKVJTJSA-N |
| XLogP | -0.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|