C6H14O2S4 — CID 119097548
(2R,3R,4R,5R)-1,3,4,6-tetrakis(sulfanyl)hexane-2,5-diol (PubChem CID 119097548) has the molecular formula C6H14O2S4 and a molecular weight of 246.44 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,3,4,6-tetrakis(sulfanyl)hexane-2,5-diol.
| Compound Name | (2R,3R,4R,5R)-1,3,4,6-tetrakis(sulfanyl)hexane-2,5-diol |
|---|---|
| PubChem CID | 119097548 |
| Molecular Formula | C6H14O2S4 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | (2R,3R,4R,5R)-1,3,4,6-tetrakis(sulfanyl)hexane-2,5-diol |
| SMILES | O[C@H](CS)[C@@H](S)[C@H](S)[C@H](O)CS |
| InChI | InChI=1S/C6H14O2S4/c7-3(1-9)5(11)6(12)4(8)2-10/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | AQLBGBDBAMQBQO-KVTDHHQDSA-N |
| XLogP | 0.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|