C6H14INO3S2 — CID 87360048
(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2-iodoacetamide (PubChem CID 87360048) has the molecular formula C6H14INO3S2 and a molecular weight of 339.22 g/mol. Its IUPAC name is (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2-iodoacetamide.
| Compound Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2-iodoacetamide |
|---|---|
| PubChem CID | 87360048 |
| Molecular Formula | C6H14INO3S2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2-iodoacetamide |
| SMILES | NC(=O)CI.O[C@H](CS)[C@H](O)CS |
| InChI | InChI=1S/C4H10O2S2.C2H4INO/c5-3(1-7)4(6)2-8;3-1-2(4)5/h3-8H,1-2H2;1H2,(H2,4,5)/t3-,4-;/m1./s1 |
| InChIKey | RGFXOVUKDPOGIW-VKKIDBQXSA-N |
| XLogP | -0.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|