About sodium;hydride;2-iodoacetamide
sodium;hydride;2-iodoacetamide (PubChem CID 173298504) has the molecular formula C2H5INNaO
and a molecular weight of 208.96 g/mol. Its IUPAC name is sodium;hydride;2-iodoacetamide.
Molecular Properties
| Compound Name | sodium;hydride;2-iodoacetamide |
| PubChem CID | 173298504 |
| Molecular Formula | C2H5INNaO |
| Molecular Weight | 208.96 g/mol |
| Exact Mass | 208.93 |
| IUPAC Name | sodium;hydride;2-iodoacetamide |
| SMILES | NC(=O)CI.[H-].[Na+] |
| InChI | InChI=1S/C2H4INO.Na.H/c3-1-2(4)5;;/h1H2,(H2,4,5);;/q;+1;-1 |
| InChIKey | MRNRJWGHZVILDB-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.96 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-iodoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-iodoacetamide?
The IUPAC name of sodium;hydride;2-iodoacetamide (CID 173298504) is sodium;hydride;2-iodoacetamide.
What is the SMILES notation for sodium;hydride;2-iodoacetamide?
The canonical SMILES for sodium;hydride;2-iodoacetamide is NC(=O)CI.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-iodoacetamide?
The InChIKey is MRNRJWGHZVILDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4INO.Na.H/c3-1-2(4)5;;/h1H2,(H2,4,5);;/q;+1;-1.
What are the key properties of sodium;hydride;2-iodoacetamide?
sodium;hydride;2-iodoacetamide has a molecular weight of 208.96 g/mol, XLogP of -2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-iodoacetamide is sourced from PubChem (CID 173298504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).