About 2-iodoacetamide;hydroiodide
2-iodoacetamide;hydroiodide (PubChem CID 172817910) has the molecular formula C2H5I2NO
and a molecular weight of 312.88 g/mol. Its IUPAC name is 2-iodoacetamide;hydroiodide.
Molecular Properties
| Compound Name | 2-iodoacetamide;hydroiodide |
| PubChem CID | 172817910 |
| Molecular Formula | C2H5I2NO |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.85 |
| IUPAC Name | 2-iodoacetamide;hydroiodide |
| SMILES | I.NC(=O)CI |
| InChI | InChI=1S/C2H4INO.HI/c3-1-2(4)5;/h1H2,(H2,4,5);1H |
| InChIKey | TUZHUNFLKOYDKO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodoacetamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodoacetamide;hydroiodide?
The IUPAC name of 2-iodoacetamide;hydroiodide (CID 172817910) is 2-iodoacetamide;hydroiodide.
What is the SMILES notation for 2-iodoacetamide;hydroiodide?
The canonical SMILES for 2-iodoacetamide;hydroiodide is I.NC(=O)CI.
What is the InChIKey of 2-iodoacetamide;hydroiodide?
The InChIKey is TUZHUNFLKOYDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4INO.HI/c3-1-2(4)5;/h1H2,(H2,4,5);1H.
What are the key properties of 2-iodoacetamide;hydroiodide?
2-iodoacetamide;hydroiodide has a molecular weight of 312.88 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodoacetamide;hydroiodide is sourced from PubChem (CID 172817910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).