About 2-aminoacetamide;methane
2-aminoacetamide;methane (PubChem CID 174826964) has the molecular formula C4H14N2O
and a molecular weight of 106.17 g/mol. Its IUPAC name is 2-aminoacetamide;methane.
Molecular Properties
| Compound Name | 2-aminoacetamide;methane |
| PubChem CID | 174826964 |
| Molecular Formula | C4H14N2O |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.11 |
| IUPAC Name | 2-aminoacetamide;methane |
| SMILES | C.C.NCC(N)=O |
| InChI | InChI=1S/C2H6N2O.2CH4/c3-1-2(4)5;;/h1,3H2,(H2,4,5);2*1H4 |
| InChIKey | HDEQAEQEAZWAKN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminoacetamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetamide;methane?
The IUPAC name of 2-aminoacetamide;methane (CID 174826964) is 2-aminoacetamide;methane.
What is the SMILES notation for 2-aminoacetamide;methane?
The canonical SMILES for 2-aminoacetamide;methane is C.C.NCC(N)=O.
What is the InChIKey of 2-aminoacetamide;methane?
The InChIKey is HDEQAEQEAZWAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.2CH4/c3-1-2(4)5;;/h1,3H2,(H2,4,5);2*1H4.
What are the key properties of 2-aminoacetamide;methane?
2-aminoacetamide;methane has a molecular weight of 106.17 g/mol, XLogP of -0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetamide;methane is sourced from PubChem (CID 174826964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).