About 2-aminoacetamide;dihydrobromide
2-aminoacetamide;dihydrobromide (PubChem CID 20567050) has the molecular formula C2H8Br2N2O
and a molecular weight of 235.91 g/mol. Its IUPAC name is 2-aminoacetamide;dihydrobromide.
Molecular Properties
| Compound Name | 2-aminoacetamide;dihydrobromide |
| PubChem CID | 20567050 |
| Molecular Formula | C2H8Br2N2O |
| Molecular Weight | 235.91 g/mol |
| Exact Mass | 233.90 |
| IUPAC Name | 2-aminoacetamide;dihydrobromide |
| SMILES | Br.Br.NCC(N)=O |
| InChI | InChI=1S/C2H6N2O.2BrH/c3-1-2(4)5;;/h1,3H2,(H2,4,5);2*1H |
| InChIKey | PBIKIVXPUOLBAX-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.91 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminoacetamide;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetamide;dihydrobromide?
The IUPAC name of 2-aminoacetamide;dihydrobromide (CID 20567050) is 2-aminoacetamide;dihydrobromide.
What is the SMILES notation for 2-aminoacetamide;dihydrobromide?
The canonical SMILES for 2-aminoacetamide;dihydrobromide is Br.Br.NCC(N)=O.
What is the InChIKey of 2-aminoacetamide;dihydrobromide?
The InChIKey is PBIKIVXPUOLBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.2BrH/c3-1-2(4)5;;/h1,3H2,(H2,4,5);2*1H.
What are the key properties of 2-aminoacetamide;dihydrobromide?
2-aminoacetamide;dihydrobromide has a molecular weight of 235.91 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetamide;dihydrobromide is sourced from PubChem (CID 20567050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).