About CID 87057822
CID 87057822 (PubChem CID 87057822) has the molecular formula C3H8KN2O
and a molecular weight of 127.21 g/mol.
Molecular Properties
| Compound Name | CID 87057822 |
| PubChem CID | 87057822 |
| Molecular Formula | C3H8KN2O |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | — |
| SMILES | NCCC(N)=O.[K] |
| InChI | InChI=1S/C3H8N2O.K/c4-2-1-3(5)6;/h1-2,4H2,(H2,5,6); |
| InChIKey | BRYKLWOWBNTKGX-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 87057822 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87057822?
The IUPAC name of CID 87057822 (CID 87057822) is not available.
What is the SMILES notation for CID 87057822?
The canonical SMILES for CID 87057822 is NCCC(N)=O.[K].
What is the InChIKey of CID 87057822?
The InChIKey is BRYKLWOWBNTKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.K/c4-2-1-3(5)6;/h1-2,4H2,(H2,5,6);.
What are the key properties of CID 87057822?
CID 87057822 has a molecular weight of 127.21 g/mol, XLogP of -1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87057822 is sourced from PubChem (CID 87057822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).