About 3-aminopropanamide;2-bromoacetamide;methanamine
3-aminopropanamide;2-bromoacetamide;methanamine (PubChem CID 159106837) has the molecular formula C6H17BrN4O2
and a molecular weight of 257.13 g/mol. Its IUPAC name is 3-aminopropanamide;2-bromoacetamide;methanamine.
Molecular Properties
| Compound Name | 3-aminopropanamide;2-bromoacetamide;methanamine |
| PubChem CID | 159106837 |
| Molecular Formula | C6H17BrN4O2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-aminopropanamide;2-bromoacetamide;methanamine |
| SMILES | CN.NC(=O)CBr.NCCC(N)=O |
| InChI | InChI=1S/C3H8N2O.C2H4BrNO.CH5N/c4-2-1-3(5)6;3-1-2(4)5;1-2/h1-2,4H2,(H2,5,6);1H2,(H2,4,5);2H2,1H3 |
| InChIKey | KDZLZOLYIKTQDA-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropanamide;2-bromoacetamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropanamide;2-bromoacetamide;methanamine?
The IUPAC name of 3-aminopropanamide;2-bromoacetamide;methanamine (CID 159106837) is 3-aminopropanamide;2-bromoacetamide;methanamine.
What is the SMILES notation for 3-aminopropanamide;2-bromoacetamide;methanamine?
The canonical SMILES for 3-aminopropanamide;2-bromoacetamide;methanamine is CN.NC(=O)CBr.NCCC(N)=O.
What is the InChIKey of 3-aminopropanamide;2-bromoacetamide;methanamine?
The InChIKey is KDZLZOLYIKTQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.C2H4BrNO.CH5N/c4-2-1-3(5)6;3-1-2(4)5;1-2/h1-2,4H2,(H2,5,6);1H2,(H2,4,5);2H2,1H3.
What are the key properties of 3-aminopropanamide;2-bromoacetamide;methanamine?
3-aminopropanamide;2-bromoacetamide;methanamine has a molecular weight of 257.13 g/mol, XLogP of -1.74, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropanamide;2-bromoacetamide;methanamine is sourced from PubChem (CID 159106837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).