About 2-(15N)azanylacetamide;hydrochloride
2-(15N)azanylacetamide;hydrochloride (PubChem CID 131708744) has the molecular formula C2H7ClN2O
and a molecular weight of 114.51 g/mol. Its IUPAC name is 2-(15N)azanylacetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(15N)azanylacetamide;hydrochloride |
| PubChem CID | 131708744 |
| Molecular Formula | C2H7ClN2O |
| Molecular Weight | 114.51 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 2-(15N)azanylacetamide;hydrochloride |
| SMILES | Cl.[15NH2][13CH2][13C]([15NH2])=O |
| InChI | InChI=1S/C2H6N2O.ClH/c3-1-2(4)5;/h1,3H2,(H2,4,5);1H/i1+1,2+1,3+1,4+1; |
| InChIKey | WKNMKGVLOWGGOU-UJNKEPEOSA-N |
| XLogP | -1.15 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.51 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(15N)azanylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(15N)azanylacetamide;hydrochloride?
The IUPAC name of 2-(15N)azanylacetamide;hydrochloride (CID 131708744) is 2-(15N)azanylacetamide;hydrochloride.
What is the SMILES notation for 2-(15N)azanylacetamide;hydrochloride?
The canonical SMILES for 2-(15N)azanylacetamide;hydrochloride is Cl.[15NH2][13CH2][13C]([15NH2])=O.
What is the InChIKey of 2-(15N)azanylacetamide;hydrochloride?
The InChIKey is WKNMKGVLOWGGOU-UJNKEPEOSA-N. The full InChI is InChI=1S/C2H6N2O.ClH/c3-1-2(4)5;/h1,3H2,(H2,4,5);1H/i1+1,2+1,3+1,4+1;.
What are the key properties of 2-(15N)azanylacetamide;hydrochloride?
2-(15N)azanylacetamide;hydrochloride has a molecular weight of 114.51 g/mol, XLogP of -1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(15N)azanylacetamide;hydrochloride is sourced from PubChem (CID 131708744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).