About stibane;2-sulfanylacetamide
stibane;2-sulfanylacetamide (PubChem CID 174949803) has the molecular formula C2H8NOSSb
and a molecular weight of 215.92 g/mol. Its IUPAC name is stibane;2-sulfanylacetamide.
Molecular Properties
| Compound Name | stibane;2-sulfanylacetamide |
| PubChem CID | 174949803 |
| Molecular Formula | C2H8NOSSb |
| Molecular Weight | 215.92 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | stibane;2-sulfanylacetamide |
| SMILES | NC(=O)CS.[SbH3] |
| InChI | InChI=1S/C2H5NOS.Sb.3H/c3-2(4)1-5;;;;/h5H,1H2,(H2,3,4);;;; |
| InChIKey | NWRPUJAGEYIPNP-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.92 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze stibane;2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stibane;2-sulfanylacetamide?
The IUPAC name of stibane;2-sulfanylacetamide (CID 174949803) is stibane;2-sulfanylacetamide.
What is the SMILES notation for stibane;2-sulfanylacetamide?
The canonical SMILES for stibane;2-sulfanylacetamide is NC(=O)CS.[SbH3].
What is the InChIKey of stibane;2-sulfanylacetamide?
The InChIKey is NWRPUJAGEYIPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NOS.Sb.3H/c3-2(4)1-5;;;;/h5H,1H2,(H2,3,4);;;;.
What are the key properties of stibane;2-sulfanylacetamide?
stibane;2-sulfanylacetamide has a molecular weight of 215.92 g/mol, XLogP of -1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for stibane;2-sulfanylacetamide is sourced from PubChem (CID 174949803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).