C4H6O3S2 — CID 87366290
2-(2-sulfanylacetyl)oxyethanethioic S-acid (PubChem CID 87366290) has the molecular formula C4H6O3S2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(2-sulfanylacetyl)oxyethanethioic S-acid.
| Compound Name | 2-(2-sulfanylacetyl)oxyethanethioic S-acid |
|---|---|
| PubChem CID | 87366290 |
| Molecular Formula | C4H6O3S2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 165.98 |
| IUPAC Name | 2-(2-sulfanylacetyl)oxyethanethioic S-acid |
| SMILES | O=C(S)COC(=O)CS |
| InChI | InChI=1S/C4H6O3S2/c5-3(2-8)7-1-4(6)9/h8H,1-2H2,(H,6,9) |
| InChIKey | TWIVTDVHYLWWNZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|