About 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane (PubChem CID 173439271) has the molecular formula C9H21O5SSb
and a molecular weight of 363.09 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane |
| PubChem CID | 173439271 |
| Molecular Formula | C9H21O5SSb |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane |
| SMILES | COCCOCCOCCOC(=O)CS.[SbH3] |
| InChI | InChI=1S/C9H18O5S.Sb.3H/c1-11-2-3-12-4-5-13-6-7-14-9(10)8-15;;;;/h15H,2-8H2,1H3;;;; |
| InChIKey | UVBDVLMWVVUEOC-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane (CID 173439271) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane is COCCOCCOCCOC(=O)CS.[SbH3].
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane?
The InChIKey is UVBDVLMWVVUEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5S.Sb.3H/c1-11-2-3-12-4-5-13-6-7-14-9(10)8-15;;;;/h15H,2-8H2,1H3;;;;.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane?
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane has a molecular weight of 363.09 g/mol, XLogP of -1.04, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-sulfanylacetate;stibane is sourced from PubChem (CID 173439271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).