C17H32O8 — CID 101278877
bis[2-(2-methoxyethoxy)ethyl] 2,3-dimethylpentanedioate (PubChem CID 101278877) has the molecular formula C17H32O8 and a molecular weight of 364.44 g/mol. Its IUPAC name is bis[2-(2-methoxyethoxy)ethyl] 2,3-dimethylpentanedioate.
| Compound Name | bis[2-(2-methoxyethoxy)ethyl] 2,3-dimethylpentanedioate |
|---|---|
| PubChem CID | 101278877 |
| Molecular Formula | C17H32O8 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | bis[2-(2-methoxyethoxy)ethyl] 2,3-dimethylpentanedioate |
| SMILES | COCCOCCOC(=O)CC(C)C(C)C(=O)OCCOCCOC |
| InChI | InChI=1S/C17H32O8/c1-14(13-16(18)24-11-9-22-7-5-20-3)15(2)17(19)25-12-10-23-8-6-21-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | BGECQPXTVKMRPY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|