About 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate
3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate (PubChem CID 101101896) has the molecular formula C10H20O5S
and a molecular weight of 252.33 g/mol. Its IUPAC name is 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate.
Molecular Properties
| Compound Name | 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| PubChem CID | 101101896 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| SMILES | COCCOCCOCC(=O)OCCCS |
| InChI | InChI=1S/C10H20O5S/c1-12-4-5-13-6-7-14-9-10(11)15-3-2-8-16/h16H,2-9H2,1H3 |
| InChIKey | RWASWKBVENAYOY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate?
The IUPAC name of 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate (CID 101101896) is 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate.
What is the SMILES notation for 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate?
The canonical SMILES for 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate is COCCOCCOCC(=O)OCCCS.
What is the InChIKey of 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate?
The InChIKey is RWASWKBVENAYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5S/c1-12-4-5-13-6-7-14-9-10(11)15-3-2-8-16/h16H,2-9H2,1H3.
What are the key properties of 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate?
3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate has a molecular weight of 252.33 g/mol, XLogP of 0.53, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpropyl 2-[2-(2-methoxyethoxy)ethoxy]acetate is sourced from PubChem (CID 101101896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).