C6H14O4S2 — CID 3053653
(2S,3R,4S,5R)-1,6-bis(sulfanyl)hexane-2,3,4,5-tetrol (PubChem CID 3053653) has the molecular formula C6H14O4S2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S,3R,4S,5R)-1,6-bis(sulfanyl)hexane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R)-1,6-bis(sulfanyl)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 3053653 |
| Molecular Formula | C6H14O4S2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | (2S,3R,4S,5R)-1,6-bis(sulfanyl)hexane-2,3,4,5-tetrol |
| SMILES | O[C@H]([C@H](O)[C@@H](O)CS)[C@H](O)CS |
| InChI | InChI=1S/C6H14O4S2/c7-3(1-11)5(9)6(10)4(8)2-12/h3-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | YBSRMLHVSWKSTA-GUCUJZIJSA-N |
| XLogP | -1.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|