C5H12O3S2 — CID 3029713
4,5-bis(sulfanyl)pentane-1,2,3-triol (PubChem CID 3029713) has the molecular formula C5H12O3S2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 4,5-bis(sulfanyl)pentane-1,2,3-triol.
| Compound Name | 4,5-bis(sulfanyl)pentane-1,2,3-triol |
|---|---|
| PubChem CID | 3029713 |
| Molecular Formula | C5H12O3S2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 4,5-bis(sulfanyl)pentane-1,2,3-triol |
| SMILES | OCC(O)C(O)C(S)CS |
| InChI | InChI=1S/C5H12O3S2/c6-1-3(7)5(8)4(10)2-9/h3-10H,1-2H2 |
| InChIKey | KMYRGCMFKAMVTI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|