C6H14O3S3 — CID 57064649
(4S,5S)-2,3,6-tris(sulfanyl)hexane-1,4,5-triol (PubChem CID 57064649) has the molecular formula C6H14O3S3 and a molecular weight of 230.38 g/mol. Its IUPAC name is (4S,5S)-2,3,6-tris(sulfanyl)hexane-1,4,5-triol.
| Compound Name | (4S,5S)-2,3,6-tris(sulfanyl)hexane-1,4,5-triol |
|---|---|
| PubChem CID | 57064649 |
| Molecular Formula | C6H14O3S3 |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | (4S,5S)-2,3,6-tris(sulfanyl)hexane-1,4,5-triol |
| SMILES | OCC(S)C(S)[C@@H](O)[C@H](O)CS |
| InChI | InChI=1S/C6H14O3S3/c7-1-4(11)6(12)5(9)3(8)2-10/h3-12H,1-2H2/t3-,4?,5+,6?/m1/s1 |
| InChIKey | CRGJSWNUYDVCRT-WLUBYYRMSA-N |
| XLogP | -0.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|