C4H11NO2S — CID 57281625
4-amino-2-sulfanylbutane-1,3-diol (PubChem CID 57281625) has the molecular formula C4H11NO2S and a molecular weight of 137.20 g/mol. Its IUPAC name is 4-amino-2-sulfanylbutane-1,3-diol.
| Compound Name | 4-amino-2-sulfanylbutane-1,3-diol |
|---|---|
| PubChem CID | 57281625 |
| Molecular Formula | C4H11NO2S |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 4-amino-2-sulfanylbutane-1,3-diol |
| SMILES | NCC(O)C(S)CO |
| InChI | InChI=1S/C4H11NO2S/c5-1-3(7)4(8)2-6/h3-4,6-8H,1-2,5H2 |
| InChIKey | MMLLVPKJQARIFM-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|