C6H17MgNO5 — CID 173212793
magnesium;(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydride (PubChem CID 173212793) has the molecular formula C6H17MgNO5 and a molecular weight of 207.51 g/mol. Its IUPAC name is magnesium;(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydride.
| Compound Name | magnesium;(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydride |
|---|---|
| PubChem CID | 173212793 |
| Molecular Formula | C6H17MgNO5 |
| Molecular Weight | 207.51 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | magnesium;(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydride |
| SMILES | NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C6H15NO5.Mg.2H/c7-1-3(9)5(11)6(12)4(10)2-8;;;/h3-6,8-12H,1-2,7H2;;;/q;+2;2*-1/t3-,4+,5+,6+;;;/m0.../s1 |
| InChIKey | VIRFQPNVLYCOGU-YZJMRIMCSA-N |
| XLogP | -3.77 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.51 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |