acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol

C7H17NO6 — CID 46915821

IUPACacetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol
SMILESCC(=O)O.NC[C@@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C5H13NO4.C2H4O2/c6-1-3(8)5(10)4(9)2-7;1-2(3)4/h3-5,7-10H,1-2,6H2;1H3,(H,3,4)/t3-,4-,5+;/m1./s1
InChIKeyATALRNUSUFMNMX-ZDQHTEEMSA-N
MW211.21 g/mol
LogP-2.89
Rot. Bonds4

About acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol

acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol (PubChem CID 46915821) has the molecular formula C7H17NO6 and a molecular weight of 211.21 g/mol. Its IUPAC name is acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol.

Molecular Properties

Compound Nameacetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol
PubChem CID46915821
Molecular FormulaC7H17NO6
Molecular Weight211.21 g/mol
Exact Mass211.11
IUPAC Nameacetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol
SMILESCC(=O)O.NC[C@@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C5H13NO4.C2H4O2/c6-1-3(8)5(10)4(9)2-7;1-2(3)4/h3-5,7-10H,1-2,6H2;1H3,(H,3,4)/t3-,4-,5+;/m1./s1
InChIKeyATALRNUSUFMNMX-ZDQHTEEMSA-N
XLogP-2.89
TPSA144.24 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500211.21
LogP ≤ 5-2.89
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol?
The IUPAC name of acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol (CID 46915821) is acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol.
What is the SMILES notation for acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol?
The canonical SMILES for acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol is CC(=O)O.NC[C@@H](O)[C@H](O)[C@H](O)CO.
What is the InChIKey of acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol?
The InChIKey is ATALRNUSUFMNMX-ZDQHTEEMSA-N. The full InChI is InChI=1S/C5H13NO4.C2H4O2/c6-1-3(8)5(10)4(9)2-7;1-2(3)4/h3-5,7-10H,1-2,6H2;1H3,(H,3,4)/t3-,4-,5+;/m1./s1.
What are the key properties of acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol?
acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol has a molecular weight of 211.21 g/mol, XLogP of -2.89, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2R,3S,4R)-5-aminopentane-1,2,3,4-tetrol is sourced from PubChem (CID 46915821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).