C12H23NO7 — CID 175332080
6-aminohexane-1,2,3,4,5-pentol;(2E,4E)-hexa-2,4-dienoic acid (PubChem CID 175332080) has the molecular formula C12H23NO7 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-aminohexane-1,2,3,4,5-pentol;(2E,4E)-hexa-2,4-dienoic acid.
| Compound Name | 6-aminohexane-1,2,3,4,5-pentol;(2E,4E)-hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 175332080 |
| Molecular Formula | C12H23NO7 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 6-aminohexane-1,2,3,4,5-pentol;(2E,4E)-hexa-2,4-dienoic acid |
| SMILES | C/C=C/C=C/C(=O)O.NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H15NO5.C6H8O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-2-3-4-5-6(7)8/h3-6,8-12H,1-2,7H2;2-5H,1H3,(H,7,8)/b;3-2+,5-4+ |
| InChIKey | YLDXQWRGFSUXLO-PLKIVWSFSA-N |
| XLogP | -2.42 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|