C22H38O14 — CID 175840392
tetrakis((E)-but-2-enoic acid);(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 175840392) has the molecular formula C22H38O14 and a molecular weight of 526.53 g/mol. Its IUPAC name is tetrakis((E)-but-2-enoic acid);(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | tetrakis((E)-but-2-enoic acid);(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 175840392 |
| Molecular Formula | C22H38O14 |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | tetrakis((E)-but-2-enoic acid);(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | C/C=C/C(=O)O.C/C=C/C(=O)O.C/C=C/C(=O)O.C/C=C/C(=O)O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H14O6.4C4H6O2/c7-1-3(9)5(11)6(12)4(10)2-8;4*1-2-3-4(5)6/h3-12H,1-2H2;4*2-3H,1H3,(H,5,6)/b;4*3-2+/t3-,4+,5-,6-;;;;/m1..../s1 |
| InChIKey | HYBHHFOFWKDYNC-GPURQVJVSA-N |
| XLogP | -1.00 |
| TPSA | 270.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|