C10H16O10 — CID 88724547
(Z)-4-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-4-oxobut-2-enoic acid (PubChem CID 88724547) has the molecular formula C10H16O10 and a molecular weight of 296.23 g/mol. Its IUPAC name is (Z)-4-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 88724547 |
| Molecular Formula | C10H16O10 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (Z)-4-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O10/c11-3-4(12)7(16)8(17)9(18)10(19)20-6(15)2-1-5(13)14/h1-2,4,7-12,16-19H,3H2,(H,13,14)/b2-1-/t4-,7-,8+,9-,10?/m1/s1 |
| InChIKey | IEQCFOPSDLDZRW-OCZRCDAXSA-N |
| XLogP | -4.08 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|