C13H18O8 — CID 67929190
[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] benzoate (PubChem CID 67929190) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] benzoate |
|---|---|
| PubChem CID | 67929190 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] benzoate |
| SMILES | O=C(OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C13H18O8/c14-6-8(15)9(16)10(17)11(18)13(20)21-12(19)7-4-2-1-3-5-7/h1-5,8-11,13-18,20H,6H2/t8-,9-,10+,11-,13?/m1/s1 |
| InChIKey | KUAFCOJSWWNFLN-TWEVDUBQSA-N |
| XLogP | -2.40 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|