C23H24O7 — CID 10927761
[(2R,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-naphthalen-1-yloxyhexan-2-yl] benzoate (PubChem CID 10927761) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-naphthalen-1-yloxyhexan-2-yl] benzoate.
| Compound Name | [(2R,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-naphthalen-1-yloxyhexan-2-yl] benzoate |
|---|---|
| PubChem CID | 10927761 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-naphthalen-1-yloxyhexan-2-yl] benzoate |
| SMILES | O=C(O[C@H](COc1cccc2ccccc12)[C@@H](O)[C@H](O)[C@@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C23H24O7/c24-13-18(25)21(26)22(27)20(30-23(28)16-8-2-1-3-9-16)14-29-19-12-6-10-15-7-4-5-11-17(15)19/h1-12,18,20-22,24-27H,13-14H2/t18-,20+,21+,22+/m0/s1 |
| InChIKey | ILECGFFBJXYFMR-BDKRGJGYSA-N |
| XLogP | 1.52 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |